C19H23NO2 — CID 101407281
N-tert-butyl-N-[(R)-phenyl-[(2R)-2-phenyloxiran-2-yl]methyl]hydroxylamine (PubChem CID 101407281) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-tert-butyl-N-[(R)-phenyl-[(2R)-2-phenyloxiran-2-yl]methyl]hydroxylamine.
| Compound Name | N-tert-butyl-N-[(R)-phenyl-[(2R)-2-phenyloxiran-2-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 101407281 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-tert-butyl-N-[(R)-phenyl-[(2R)-2-phenyloxiran-2-yl]methyl]hydroxylamine |
| SMILES | CC(C)(C)N(O)[C@H](c1ccccc1)[C@]1(c2ccccc2)CO1 |
| InChI | InChI=1S/C19H23NO2/c1-18(2,3)20(21)17(15-10-6-4-7-11-15)19(14-22-19)16-12-8-5-9-13-16/h4-13,17,21H,14H2,1-3H3/t17-,19-/m1/s1 |
| InChIKey | HAISXLFPHVLSEK-IEBWSBKVSA-N |
| XLogP | 4.14 |
| TPSA | 36.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|