C30H43NO4 — CID 10140736
(1R,3Z,7S,9E,11S,15S,17R)-11-hydroxy-15-methyl-7-[(E)-3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13-methylidene-21-oxa-6-azabicyclo[15.3.1]henicosa-3,9,19-trien-5-one (PubChem CID 10140736) has the molecular formula C30H43NO4 and a molecular weight of 481.68 g/mol. Its IUPAC name is (1R,3Z,7S,9E,11S,15S,17R)-11-hydroxy-15-methyl-7-[(E)-3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13-methylidene-21-oxa-6-azabicyclo[15.3.1]henicosa-3,9,19-trien-5-one.
| Compound Name | (1R,3Z,7S,9E,11S,15S,17R)-11-hydroxy-15-methyl-7-[(E)-3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13-methylidene-21-oxa-6-azabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
|---|---|
| PubChem CID | 10140736 |
| Molecular Formula | C30H43NO4 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.32 |
| IUPAC Name | (1R,3Z,7S,9E,11S,15S,17R)-11-hydroxy-15-methyl-7-[(E)-3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-enyl]-13-methylidene-21-oxa-6-azabicyclo[15.3.1]henicosa-3,9,19-trien-5-one |
| SMILES | C=C1C[C@H](C)C[C@@H]2CC=C[C@@H](C/C=C\C(=O)N[C@H](C/C=C/[C@@H]3CC(C)=CCO3)C/C=C/[C@@H](O)C1)O2 |
| InChI | InChI=1S/C30H43NO4/c1-22-16-17-34-28(20-22)13-5-9-25-8-4-10-26(32)19-23(2)18-24(3)21-29-14-6-11-27(35-29)12-7-15-30(33)31-25/h4-7,10-11,13,15-16,24-29,32H,2,8-9,12,14,17-21H2,1,3H3,(H,31,33)/b10-4+,13-5+,15-7-/t24-,25-,26+,27-,28+,29-/m0/s1 |
| InChIKey | FLCVFHCXJOAKFO-UMWWGBETSA-N |
| XLogP | 5.50 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|