C16H30O2Si — CID 101407451
[(1R,5S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-6-bicyclo[3.1.1]hept-2-enyl]methanol (PubChem CID 101407451) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is [(1R,5S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-6-bicyclo[3.1.1]hept-2-enyl]methanol.
| Compound Name | [(1R,5S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-6-bicyclo[3.1.1]hept-2-enyl]methanol |
|---|---|
| PubChem CID | 101407451 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | [(1R,5S,6R)-1-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethyl-6-bicyclo[3.1.1]hept-2-enyl]methanol |
| SMILES | CC1=CC[C@H]2C[C@]1(O[Si](C)(C)C(C)(C)C)[C@@]2(C)CO |
| InChI | InChI=1S/C16H30O2Si/c1-12-8-9-13-10-16(12,15(13,5)11-17)18-19(6,7)14(2,3)4/h8,13,17H,9-11H2,1-7H3/t13-,15-,16+/m0/s1 |
| InChIKey | UPXHIQAUJNPRSD-CWRNSKLLSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|