C24H30O12 — CID 101407458
[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[(1R,4S,5R,6S,7R,8S,9S)-4,5,6-trihydroxy-2,10-dioxatricyclo[5.3.1.04,8]undecan-9-yl]oxy]oxan-2-yl]methyl (E)-3-phenylprop-2-enoate (PubChem CID 101407458) has the molecular formula C24H30O12 and a molecular weight of 510.49 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[(1R,4S,5R,6S,7R,8S,9S)-4,5,6-trihydroxy-2,10-dioxatricyclo[5.3.1.04,8]undecan-9-yl]oxy]oxan-2-yl]methyl (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[(1R,4S,5R,6S,7R,8S,9S)-4,5,6-trihydroxy-2,10-dioxatricyclo[5.3.1.04,8]undecan-9-yl]oxy]oxan-2-yl]methyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 101407458 |
| Molecular Formula | C24H30O12 |
| Molecular Weight | 510.49 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[[(1R,4S,5R,6S,7R,8S,9S)-4,5,6-trihydroxy-2,10-dioxatricyclo[5.3.1.04,8]undecan-9-yl]oxy]oxan-2-yl]methyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OC[C@H]1O[C@@H](O[C@@H]2O[C@@H]3C[C@H]4[C@H](O)[C@@H](O)[C@@](O)(CO3)[C@@H]24)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H30O12/c25-14(7-6-11-4-2-1-3-5-11)32-9-13-18(27)19(28)20(29)23(34-13)36-22-16-12-8-15(35-22)33-10-24(16,31)21(30)17(12)26/h1-7,12-13,15-23,26-31H,8-10H2/b7-6+/t12-,13-,15-,16-,17+,18-,19+,20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | QIMNZOQHKVLDAD-OSBIBARKSA-N |
| XLogP | -2.13 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.49 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|