C24H17F3N4O4 — CID 10140754
(10R)-10-(1,3-benzodioxol-5-yl)-1-(trifluoromethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-2,3-dicarboxamide (PubChem CID 10140754) has the molecular formula C24H17F3N4O4 and a molecular weight of 482.42 g/mol. Its IUPAC name is (10R)-10-(1,3-benzodioxol-5-yl)-1-(trifluoromethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-2,3-dicarboxamide.
| Compound Name | (10R)-10-(1,3-benzodioxol-5-yl)-1-(trifluoromethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-2,3-dicarboxamide |
|---|---|
| PubChem CID | 10140754 |
| Molecular Formula | C24H17F3N4O4 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | (10R)-10-(1,3-benzodioxol-5-yl)-1-(trifluoromethyl)-9,10-dihydro-4H-indolizino[6,7-b]indole-2,3-dicarboxamide |
| SMILES | NC(=O)c1c(C(N)=O)c(C(F)(F)F)n2c1Cc1c([nH]c3ccccc13)[C@H]2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H17F3N4O4/c25-24(26,27)21-18(23(29)33)17(22(28)32)14-8-12-11-3-1-2-4-13(11)30-19(12)20(31(14)21)10-5-6-15-16(7-10)35-9-34-15/h1-7,20,30H,8-9H2,(H2,28,32)(H2,29,33)/t20-/m1/s1 |
| InChIKey | KTWXXDHSTMBFTQ-HXUWFJFHSA-N |
| XLogP | 3.46 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|