About 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid
5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid (PubChem CID 1014076) has the molecular formula C16H11ClN2O3S2
and a molecular weight of 378.86 g/mol. Its IUPAC name is 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid.
Molecular Properties
| Compound Name | 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid |
| PubChem CID | 1014076 |
| Molecular Formula | C16H11ClN2O3S2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid |
| SMILES | O=C(CSc1nc2ccccc2s1)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H11ClN2O3S2/c17-11-6-5-9(7-10(11)15(21)22)18-14(20)8-23-16-19-12-3-1-2-4-13(12)24-16/h1-7H,8H2,(H,18,20)(H,21,22) |
| InChIKey | FMWAKULYQKGNCU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid?
The IUPAC name of 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid (CID 1014076) is 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid.
What is the SMILES notation for 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid?
The canonical SMILES for 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid is O=C(CSc1nc2ccccc2s1)Nc1ccc(Cl)c(C(=O)O)c1.
What is the InChIKey of 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid?
The InChIKey is FMWAKULYQKGNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2O3S2/c17-11-6-5-9(7-10(11)15(21)22)18-14(20)8-23-16-19-12-3-1-2-4-13(12)24-16/h1-7H,8H2,(H,18,20)(H,21,22).
What are the key properties of 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid?
5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid has a molecular weight of 378.86 g/mol, XLogP of 4.38, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]-2-chlorobenzoic acid is sourced from PubChem (CID 1014076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).