C40H30F26NOP — CID 101407727
[2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyl]phosphane (PubChem CID 101407727) has the molecular formula C40H30F26NOP and a molecular weight of 1065.61 g/mol. Its IUPAC name is [2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyl]phosphane.
| Compound Name | [2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyl]phosphane |
|---|---|
| PubChem CID | 101407727 |
| Molecular Formula | C40H30F26NOP |
| Molecular Weight | 1065.61 g/mol |
| Exact Mass | 1065.16 |
| IUPAC Name | [2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis[2-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)phenyl]phosphane |
| SMILES | CC(C)C1COC(c2ccccc2P(c2ccccc2CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2ccccc2CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=N1 |
| InChI | InChI=1S/C40H30F26NOP/c1-20(2)24-19-68-28(67-24)23-11-5-8-14-27(23)69(25-12-6-3-9-21(25)15-17-29(41,42)31(45,46)33(49,50)35(53,54)37(57,58)39(61,62)63)26-13-7-4-10-22(26)16-18-30(43,44)32(47,48)34(51,52)36(55,56)38(59,60)40(64,65)66/h3-14,20,24H,15-19H2,1-2H3 |
| InChIKey | IUXKSIMNKWAKGR-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.61 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|