C15H13F17O2S — CID 101407730
S-tert-butyl (3R)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-hydroxyundecanethioate (PubChem CID 101407730) has the molecular formula C15H13F17O2S and a molecular weight of 580.30 g/mol. Its IUPAC name is S-tert-butyl (3R)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-hydroxyundecanethioate.
| Compound Name | S-tert-butyl (3R)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-hydroxyundecanethioate |
|---|---|
| PubChem CID | 101407730 |
| Molecular Formula | C15H13F17O2S |
| Molecular Weight | 580.30 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | S-tert-butyl (3R)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-hydroxyundecanethioate |
| SMILES | CC(C)(C)SC(=O)C[C@@H](O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H13F17O2S/c1-7(2,3)35-6(34)4-5(33)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h5,33H,4H2,1-3H3/t5-/m1/s1 |
| InChIKey | MZXVJLOLYQJNKK-RXMQYKEDSA-N |
| XLogP | 6.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.30 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|