About 1,2-dimethyl-2H-pyridine-3,4-diol
1,2-dimethyl-2H-pyridine-3,4-diol (PubChem CID 101407849) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 1,2-dimethyl-2H-pyridine-3,4-diol.
Molecular Properties
| Compound Name | 1,2-dimethyl-2H-pyridine-3,4-diol |
| PubChem CID | 101407849 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 1,2-dimethyl-2H-pyridine-3,4-diol |
| SMILES | CC1C(O)=C(O)C=CN1C |
| InChI | InChI=1S/C7H11NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-5,9-10H,1-2H3 |
| InChIKey | QBFHRWLODALVSR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dimethyl-2H-pyridine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-2H-pyridine-3,4-diol?
The IUPAC name of 1,2-dimethyl-2H-pyridine-3,4-diol (CID 101407849) is 1,2-dimethyl-2H-pyridine-3,4-diol.
What is the SMILES notation for 1,2-dimethyl-2H-pyridine-3,4-diol?
The canonical SMILES for 1,2-dimethyl-2H-pyridine-3,4-diol is CC1C(O)=C(O)C=CN1C.
What is the InChIKey of 1,2-dimethyl-2H-pyridine-3,4-diol?
The InChIKey is QBFHRWLODALVSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-5,9-10H,1-2H3.
What are the key properties of 1,2-dimethyl-2H-pyridine-3,4-diol?
1,2-dimethyl-2H-pyridine-3,4-diol has a molecular weight of 141.17 g/mol, XLogP of 1.16, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-2H-pyridine-3,4-diol is sourced from PubChem (CID 101407849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).