About (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine
(2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine (PubChem CID 101407871) has the molecular formula C18H26N2O3
and a molecular weight of 318.42 g/mol. Its IUPAC name is (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine.
Molecular Properties
| Compound Name | (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine |
| PubChem CID | 101407871 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine |
| SMILES | COC1=N[C@](C)(COCc2ccccc2)C(OC)=N[C@H]1C(C)C |
| InChI | InChI=1S/C18H26N2O3/c1-13(2)15-16(21-4)20-18(3,17(19-15)22-5)12-23-11-14-9-7-6-8-10-14/h6-10,13,15H,11-12H2,1-5H3/t15-,18+/m0/s1 |
| InChIKey | CHYFPYYHWJTQBW-MAUKXSAKSA-N |
| XLogP | 3.09 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine?
The IUPAC name of (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine (CID 101407871) is (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine.
What is the SMILES notation for (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine?
The canonical SMILES for (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine is COC1=N[C@](C)(COCc2ccccc2)C(OC)=N[C@H]1C(C)C.
What is the InChIKey of (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine?
The InChIKey is CHYFPYYHWJTQBW-MAUKXSAKSA-N. The full InChI is InChI=1S/C18H26N2O3/c1-13(2)15-16(21-4)20-18(3,17(19-15)22-5)12-23-11-14-9-7-6-8-10-14/h6-10,13,15H,11-12H2,1-5H3/t15-,18+/m0/s1.
What are the key properties of (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine?
(2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine has a molecular weight of 318.42 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-3,6-dimethoxy-5-methyl-5-(phenylmethoxymethyl)-2-propan-2-yl-2H-pyrazine is sourced from PubChem (CID 101407871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).