About 2-hex-5-en-2-ylaniline
2-hex-5-en-2-ylaniline (PubChem CID 101407888) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-hex-5-en-2-ylaniline.
Molecular Properties
| Compound Name | 2-hex-5-en-2-ylaniline |
| PubChem CID | 101407888 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-hex-5-en-2-ylaniline |
| SMILES | C=CCCC(C)c1ccccc1N |
| InChI | InChI=1S/C12H17N/c1-3-4-7-10(2)11-8-5-6-9-12(11)13/h3,5-6,8-10H,1,4,7,13H2,2H3 |
| InChIKey | JJPJRLVSCMBREG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hex-5-en-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-5-en-2-ylaniline?
The IUPAC name of 2-hex-5-en-2-ylaniline (CID 101407888) is 2-hex-5-en-2-ylaniline.
What is the SMILES notation for 2-hex-5-en-2-ylaniline?
The canonical SMILES for 2-hex-5-en-2-ylaniline is C=CCCC(C)c1ccccc1N.
What is the InChIKey of 2-hex-5-en-2-ylaniline?
The InChIKey is JJPJRLVSCMBREG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-3-4-7-10(2)11-8-5-6-9-12(11)13/h3,5-6,8-10H,1,4,7,13H2,2H3.
What are the key properties of 2-hex-5-en-2-ylaniline?
2-hex-5-en-2-ylaniline has a molecular weight of 175.27 g/mol, XLogP of 3.34, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-5-en-2-ylaniline is sourced from PubChem (CID 101407888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).