C23H11F5O — CID 101408023
(1S)-3-anthracen-9-yl-1-(2,3,4,5,6-pentafluorophenyl)prop-2-yn-1-ol (PubChem CID 101408023) has the molecular formula C23H11F5O and a molecular weight of 398.33 g/mol. Its IUPAC name is (1S)-3-anthracen-9-yl-1-(2,3,4,5,6-pentafluorophenyl)prop-2-yn-1-ol.
| Compound Name | (1S)-3-anthracen-9-yl-1-(2,3,4,5,6-pentafluorophenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 101408023 |
| Molecular Formula | C23H11F5O |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (1S)-3-anthracen-9-yl-1-(2,3,4,5,6-pentafluorophenyl)prop-2-yn-1-ol |
| SMILES | O[C@@H](C#Cc1c2ccccc2cc2ccccc12)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C23H11F5O/c24-19-18(20(25)22(27)23(28)21(19)26)17(29)10-9-16-14-7-3-1-5-12(14)11-13-6-2-4-8-15(13)16/h1-8,11,17,29H/t17-/m0/s1 |
| InChIKey | YCOTWZFTDXAPLX-KRWDZBQOSA-N |
| XLogP | 5.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|