C18H24O5 — CID 101408092
methyl (1R,2R,6S,7S,8R,10S,12R)-1,4,4,10-tetramethyl-11-oxo-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-10-carboxylate (PubChem CID 101408092) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is methyl (1R,2R,6S,7S,8R,10S,12R)-1,4,4,10-tetramethyl-11-oxo-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-10-carboxylate.
| Compound Name | methyl (1R,2R,6S,7S,8R,10S,12R)-1,4,4,10-tetramethyl-11-oxo-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-10-carboxylate |
|---|---|
| PubChem CID | 101408092 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | methyl (1R,2R,6S,7S,8R,10S,12R)-1,4,4,10-tetramethyl-11-oxo-3,5-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-10-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@@H]2[C@@H]3C=C[C@](C)([C@@H]2C1=O)[C@H]1OC(C)(C)O[C@@H]31 |
| InChI | InChI=1S/C18H24O5/c1-16(2)22-12-9-6-7-17(3,14(12)23-16)11-10(9)8-18(4,13(11)19)15(20)21-5/h6-7,9-12,14H,8H2,1-5H3/t9-,10+,11-,12-,14-,17+,18-/m0/s1 |
| InChIKey | FQXQKFKLTRNOSZ-ZXEPNJKCSA-N |
| XLogP | 2.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|