C12H12O7 — CID 101408129
trimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-1,2,3-tricarboxylate (PubChem CID 101408129) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is trimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-1,2,3-tricarboxylate.
| Compound Name | trimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 101408129 |
| Molecular Formula | C12H12O7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | trimethyl 7-oxabicyclo[2.2.1]hepta-2,5-diene-1,2,3-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(=O)OC)C=CC1O2 |
| InChI | InChI=1S/C12H12O7/c1-16-9(13)7-6-4-5-12(19-6,11(15)18-3)8(7)10(14)17-2/h4-6H,1-3H3 |
| InChIKey | LJBNBIYAXVXYNO-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|