C24H8F12I2 — CID 101408260
2,8-diiodo-6,6,12,12-tetrakis(trifluoromethyl)indeno[1,2-b]fluorene (PubChem CID 101408260) has the molecular formula C24H8F12I2 and a molecular weight of 778.11 g/mol. Its IUPAC name is 2,8-diiodo-6,6,12,12-tetrakis(trifluoromethyl)indeno[1,2-b]fluorene.
| Compound Name | 2,8-diiodo-6,6,12,12-tetrakis(trifluoromethyl)indeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 101408260 |
| Molecular Formula | C24H8F12I2 |
| Molecular Weight | 778.11 g/mol |
| Exact Mass | 777.85 |
| IUPAC Name | 2,8-diiodo-6,6,12,12-tetrakis(trifluoromethyl)indeno[1,2-b]fluorene |
| SMILES | FC(F)(F)C1(C(F)(F)F)c2cc(I)ccc2-c2cc3c(cc21)-c1ccc(I)cc1C3(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H8F12I2/c25-21(26,27)19(22(28,29)30)15-5-9(37)1-3-11(15)13-7-18-14(8-17(13)19)12-4-2-10(38)6-16(12)20(18,23(31,32)33)24(34,35)36/h1-8H |
| InChIKey | QNYDJHPBRHSDAQ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.11 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|