C11H16O — CID 101408374
(1S,2S,5S)-2-ethenyl-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-ol (PubChem CID 101408374) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (1S,2S,5S)-2-ethenyl-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-ol.
| Compound Name | (1S,2S,5S)-2-ethenyl-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-ol |
|---|---|
| PubChem CID | 101408374 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (1S,2S,5S)-2-ethenyl-6,6-dimethylbicyclo[3.1.1]hept-3-en-2-ol |
| SMILES | C=C[C@]1(O)C=C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C11H16O/c1-4-11(12)6-5-8-7-9(11)10(8,2)3/h4-6,8-9,12H,1,7H2,2-3H3/t8-,9+,11+/m1/s1 |
| InChIKey | UZYUQWRBHSIYON-YWVKMMECSA-N |
| XLogP | 2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|