About 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one
6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one (PubChem CID 101408508) has the molecular formula C10H13N5O
and a molecular weight of 219.25 g/mol. Its IUPAC name is 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one.
Molecular Properties
| Compound Name | 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one |
| PubChem CID | 101408508 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one |
| SMILES | CC(C)=CCNc1ncnc2[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C10H13N5O/c1-6(2)3-4-11-8-7-9(13-5-12-8)15-10(16)14-7/h3,5H,4H2,1-2H3,(H3,11,12,13,14,15,16) |
| InChIKey | OVXPEDNPPMVUNR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one?
The IUPAC name of 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one (CID 101408508) is 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one.
What is the SMILES notation for 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one?
The canonical SMILES for 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one is CC(C)=CCNc1ncnc2[nH]c(=O)[nH]c12.
What is the InChIKey of 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one?
The InChIKey is OVXPEDNPPMVUNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5O/c1-6(2)3-4-11-8-7-9(13-5-12-8)15-10(16)14-7/h3,5H,4H2,1-2H3,(H3,11,12,13,14,15,16).
What are the key properties of 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one?
6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one has a molecular weight of 219.25 g/mol, XLogP of 1.02, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methylbut-2-enylamino)-7,9-dihydropurin-8-one is sourced from PubChem (CID 101408508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).