C25H40Si2 — CID 101408626
hex-5-enyl-[(1R)-3-[hex-5-enyl(dimethyl)silyl]-1H-inden-1-yl]-dimethylsilane (PubChem CID 101408626) has the molecular formula C25H40Si2 and a molecular weight of 396.77 g/mol. Its IUPAC name is hex-5-enyl-[(1R)-3-[hex-5-enyl(dimethyl)silyl]-1H-inden-1-yl]-dimethylsilane.
| Compound Name | hex-5-enyl-[(1R)-3-[hex-5-enyl(dimethyl)silyl]-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 101408626 |
| Molecular Formula | C25H40Si2 |
| Molecular Weight | 396.77 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | hex-5-enyl-[(1R)-3-[hex-5-enyl(dimethyl)silyl]-1H-inden-1-yl]-dimethylsilane |
| SMILES | C=CCCCC[Si](C)(C)C1=C[C@@H]([Si](C)(C)CCCCC=C)c2ccccc21 |
| InChI | InChI=1S/C25H40Si2/c1-7-9-11-15-19-26(3,4)24-21-25(23-18-14-13-17-22(23)24)27(5,6)20-16-12-10-8-2/h7-8,13-14,17-18,21,24H,1-2,9-12,15-16,19-20H2,3-6H3/t24-/m1/s1 |
| InChIKey | BLHNOCFLCPSPAM-XMMPIXPASA-N |
| XLogP | 8.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.77 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|