C23H24N4O6S — CID 10140871
N-[6-(4-hydroxybut-2-ynoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide (PubChem CID 10140871) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is N-[6-(4-hydroxybut-2-ynoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide.
| Compound Name | N-[6-(4-hydroxybut-2-ynoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 10140871 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | N-[6-(4-hydroxybut-2-ynoxy)-5-(2-methoxyphenoxy)pyrimidin-4-yl]-5-propan-2-ylpyridine-2-sulfonamide |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C(C)C)cn2)ncnc1OCC#CCO |
| InChI | InChI=1S/C23H24N4O6S/c1-16(2)17-10-11-20(24-14-17)34(29,30)27-22-21(33-19-9-5-4-8-18(19)31-3)23(26-15-25-22)32-13-7-6-12-28/h4-5,8-11,14-16,28H,12-13H2,1-3H3,(H,25,26,27) |
| InChIKey | WITCSGJQNAEGBT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|