About 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one
6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one (PubChem CID 101409158) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one.
Molecular Properties
| Compound Name | 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one |
| PubChem CID | 101409158 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one |
| SMILES | O=C1C=CC2=CC(O)CC2O1 |
| InChI | InChI=1S/C8H8O3/c9-6-3-5-1-2-8(10)11-7(5)4-6/h1-3,6-7,9H,4H2 |
| InChIKey | OILJPEOTAOIWTL-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one?
The IUPAC name of 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one (CID 101409158) is 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one.
What is the SMILES notation for 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one?
The canonical SMILES for 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one is O=C1C=CC2=CC(O)CC2O1.
What is the InChIKey of 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one?
The InChIKey is OILJPEOTAOIWTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c9-6-3-5-1-2-8(10)11-7(5)4-6/h1-3,6-7,9H,4H2.
What are the key properties of 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one?
6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one has a molecular weight of 152.15 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-7,7a-dihydro-6H-cyclopenta[b]pyran-2-one is sourced from PubChem (CID 101409158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).