C16H22O5 — CID 101409341
dimethyl (1R,2S,5R)-5-ethoxytricyclo[5.3.0.02,5]dec-6-ene-9,9-dicarboxylate (PubChem CID 101409341) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is dimethyl (1R,2S,5R)-5-ethoxytricyclo[5.3.0.02,5]dec-6-ene-9,9-dicarboxylate.
| Compound Name | dimethyl (1R,2S,5R)-5-ethoxytricyclo[5.3.0.02,5]dec-6-ene-9,9-dicarboxylate |
|---|---|
| PubChem CID | 101409341 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | dimethyl (1R,2S,5R)-5-ethoxytricyclo[5.3.0.02,5]dec-6-ene-9,9-dicarboxylate |
| SMILES | CCO[C@@]12C=C3CC(C(=O)OC)(C(=O)OC)C[C@@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C16H22O5/c1-4-21-16-6-5-12(16)11-9-15(13(17)19-2,14(18)20-3)7-10(11)8-16/h8,11-12H,4-7,9H2,1-3H3/t11-,12-,16-/m0/s1 |
| InChIKey | XJMSSAUUVYMBRV-MKBNYLNASA-N |
| XLogP | 1.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|