C21H40OSi — CID 101409489
[(2R,3R,4S,5S)-2,5-bis(ethenyl)-3,4-dipropylcyclopentyl]oxy-tert-butyl-dimethylsilane (PubChem CID 101409489) has the molecular formula C21H40OSi and a molecular weight of 336.64 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2,5-bis(ethenyl)-3,4-dipropylcyclopentyl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,4S,5S)-2,5-bis(ethenyl)-3,4-dipropylcyclopentyl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101409489 |
| Molecular Formula | C21H40OSi |
| Molecular Weight | 336.64 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | [(2R,3R,4S,5S)-2,5-bis(ethenyl)-3,4-dipropylcyclopentyl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@@H]1C(O[Si](C)(C)C(C)(C)C)[C@H](C=C)[C@H](CCC)[C@@H]1CCC |
| InChI | InChI=1S/C21H40OSi/c1-10-14-18-16(12-3)20(17(13-4)19(18)15-11-2)22-23(8,9)21(5,6)7/h12-13,16-20H,3-4,10-11,14-15H2,1-2,5-9H3/t16-,17+,18+,19-,20? |
| InChIKey | KZHPIFGFYIJTAZ-SYBFEITBSA-N |
| XLogP | 6.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.64 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|