About 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate
2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate (PubChem CID 101409779) has the molecular formula C12H23F2NO2Si
and a molecular weight of 279.40 g/mol. Its IUPAC name is 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate |
| PubChem CID | 101409779 |
| Molecular Formula | C12H23F2NO2Si |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)[C@@]1(N)CCCCC1(F)F |
| InChI | InChI=1S/C12H23F2NO2Si/c1-18(2,3)9-8-17-10(16)11(15)6-4-5-7-12(11,13)14/h4-9,15H2,1-3H3/t11-/m0/s1 |
| InChIKey | KFUUFVRAPBELOB-NSHDSACASA-N |
| XLogP | 2.77 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate?
The IUPAC name of 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate (CID 101409779) is 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate.
What is the SMILES notation for 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate?
The canonical SMILES for 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate is C[Si](C)(C)CCOC(=O)[C@@]1(N)CCCCC1(F)F.
What is the InChIKey of 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate?
The InChIKey is KFUUFVRAPBELOB-NSHDSACASA-N. The full InChI is InChI=1S/C12H23F2NO2Si/c1-18(2,3)9-8-17-10(16)11(15)6-4-5-7-12(11,13)14/h4-9,15H2,1-3H3/t11-/m0/s1.
What are the key properties of 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate?
2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate has a molecular weight of 279.40 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl (1S)-1-amino-2,2-difluorocyclohexane-1-carboxylate is sourced from PubChem (CID 101409779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).