C12H17N3O4 — CID 101410076
[(2S,3S,6S)-6-ethoxy-3-(triazol-1-yl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 101410076) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is [(2S,3S,6S)-6-ethoxy-3-(triazol-1-yl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6S)-6-ethoxy-3-(triazol-1-yl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101410076 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | [(2S,3S,6S)-6-ethoxy-3-(triazol-1-yl)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CCO[C@@H]1C=C[C@H](n2ccnn2)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C12H17N3O4/c1-3-17-12-5-4-10(15-7-6-13-14-15)11(19-12)8-18-9(2)16/h4-7,10-12H,3,8H2,1-2H3/t10-,11+,12-/m0/s1 |
| InChIKey | CUOAHINYCPSDOJ-TUAOUCFPSA-N |
| XLogP | 0.70 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|