About (E)-nonadec-14-enoic acid
(E)-nonadec-14-enoic acid (PubChem CID 101410255) has the molecular formula C19H36O2
and a molecular weight of 296.50 g/mol. Its IUPAC name is (E)-nonadec-14-enoic acid.
Molecular Properties
| Compound Name | (E)-nonadec-14-enoic acid |
| PubChem CID | 101410255 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | (E)-nonadec-14-enoic acid |
| SMILES | CCCC/C=C/CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h5-6H,2-4,7-18H2,1H3,(H,20,21)/b6-5+ |
| InChIKey | AJILFHGWPOOFOW-AATRIKPKSA-N |
| XLogP | 6.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-nonadec-14-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-nonadec-14-enoic acid?
The IUPAC name of (E)-nonadec-14-enoic acid (CID 101410255) is (E)-nonadec-14-enoic acid.
What is the SMILES notation for (E)-nonadec-14-enoic acid?
The canonical SMILES for (E)-nonadec-14-enoic acid is CCCC/C=C/CCCCCCCCCCCCC(=O)O.
What is the InChIKey of (E)-nonadec-14-enoic acid?
The InChIKey is AJILFHGWPOOFOW-AATRIKPKSA-N. The full InChI is InChI=1S/C19H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21/h5-6H,2-4,7-18H2,1H3,(H,20,21)/b6-5+.
What are the key properties of (E)-nonadec-14-enoic acid?
(E)-nonadec-14-enoic acid has a molecular weight of 296.50 g/mol, XLogP of 6.50, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-nonadec-14-enoic acid is sourced from PubChem (CID 101410255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).