C31H25N5O2 — CID 101410491
2-[4-[2-(2,4-dimethoxyphenyl)ethynyl]-6-(1-methylbenzimidazol-2-yl)-2-pyridinyl]-1-methylbenzimidazole (PubChem CID 101410491) has the molecular formula C31H25N5O2 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-[4-[2-(2,4-dimethoxyphenyl)ethynyl]-6-(1-methylbenzimidazol-2-yl)-2-pyridinyl]-1-methylbenzimidazole.
| Compound Name | 2-[4-[2-(2,4-dimethoxyphenyl)ethynyl]-6-(1-methylbenzimidazol-2-yl)-2-pyridinyl]-1-methylbenzimidazole |
|---|---|
| PubChem CID | 101410491 |
| Molecular Formula | C31H25N5O2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 2-[4-[2-(2,4-dimethoxyphenyl)ethynyl]-6-(1-methylbenzimidazol-2-yl)-2-pyridinyl]-1-methylbenzimidazole |
| SMILES | COc1ccc(C#Cc2cc(-c3nc4ccccc4n3C)nc(-c3nc4ccccc4n3C)c2)c(OC)c1 |
| InChI | InChI=1S/C31H25N5O2/c1-35-27-11-7-5-9-23(27)33-30(35)25-17-20(13-14-21-15-16-22(37-3)19-29(21)38-4)18-26(32-25)31-34-24-10-6-8-12-28(24)36(31)2/h5-12,15-19H,1-4H3 |
| InChIKey | JQVVKOVWHUEAII-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|