C8H9NO3 — CID 101410566
(2E)-2-[(4R,5R,6S)-4,5,6-trihydroxycyclohex-2-en-1-ylidene]acetonitrile (PubChem CID 101410566) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is (2E)-2-[(4R,5R,6S)-4,5,6-trihydroxycyclohex-2-en-1-ylidene]acetonitrile.
| Compound Name | (2E)-2-[(4R,5R,6S)-4,5,6-trihydroxycyclohex-2-en-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 101410566 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | (2E)-2-[(4R,5R,6S)-4,5,6-trihydroxycyclohex-2-en-1-ylidene]acetonitrile |
| SMILES | N#C/C=C1\C=C[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H9NO3/c9-4-3-5-1-2-6(10)8(12)7(5)11/h1-3,6-8,10-12H/b5-3+/t6-,7+,8-/m1/s1 |
| InChIKey | SIKDHUUZRZDYPO-ZXHNMSBYSA-N |
| XLogP | -0.91 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|