C16H24O3 — CID 101410631
1-[1-(2,8,8-trimethyl-7,9-dioxaspiro[4.5]dec-2-en-4-yl)cyclopropyl]ethanone (PubChem CID 101410631) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 1-[1-(2,8,8-trimethyl-7,9-dioxaspiro[4.5]dec-2-en-4-yl)cyclopropyl]ethanone.
| Compound Name | 1-[1-(2,8,8-trimethyl-7,9-dioxaspiro[4.5]dec-2-en-4-yl)cyclopropyl]ethanone |
|---|---|
| PubChem CID | 101410631 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1-[1-(2,8,8-trimethyl-7,9-dioxaspiro[4.5]dec-2-en-4-yl)cyclopropyl]ethanone |
| SMILES | CC(=O)C1(C2C=C(C)CC23COC(C)(C)OC3)CC1 |
| InChI | InChI=1S/C16H24O3/c1-11-7-13(16(5-6-16)12(2)17)15(8-11)9-18-14(3,4)19-10-15/h7,13H,5-6,8-10H2,1-4H3 |
| InChIKey | CTWPYKDGXLEZBO-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|