C17H18N4O2 — CID 101410731
11-(1-ethoxyethenyl)-2,9-dimethyl-2,4,9,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-7-carbaldehyde (PubChem CID 101410731) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 11-(1-ethoxyethenyl)-2,9-dimethyl-2,4,9,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-7-carbaldehyde.
| Compound Name | 11-(1-ethoxyethenyl)-2,9-dimethyl-2,4,9,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-7-carbaldehyde |
|---|---|
| PubChem CID | 101410731 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 11-(1-ethoxyethenyl)-2,9-dimethyl-2,4,9,14-tetrazatricyclo[8.4.0.03,8]tetradeca-1(14),3,5,7,10,12-hexaene-7-carbaldehyde |
| SMILES | C=C(OCC)c1ccnc2c1N(C)c1c(C=O)ccnc1N2C |
| InChI | InChI=1S/C17H18N4O2/c1-5-23-11(2)13-7-9-19-17-15(13)20(3)14-12(10-22)6-8-18-16(14)21(17)4/h6-10H,2,5H2,1,3-4H3 |
| InChIKey | SSEUBEAKODWAMS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|