C19H30O — CID 101411113
1-[(1S,3aS,6aR)-2-(2,2-dimethylpropyl)-1,3a,4,5,6,6a-hexahydropentalen-1-yl]cyclohex-2-en-1-ol (PubChem CID 101411113) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-[(1S,3aS,6aR)-2-(2,2-dimethylpropyl)-1,3a,4,5,6,6a-hexahydropentalen-1-yl]cyclohex-2-en-1-ol.
| Compound Name | 1-[(1S,3aS,6aR)-2-(2,2-dimethylpropyl)-1,3a,4,5,6,6a-hexahydropentalen-1-yl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 101411113 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 1-[(1S,3aS,6aR)-2-(2,2-dimethylpropyl)-1,3a,4,5,6,6a-hexahydropentalen-1-yl]cyclohex-2-en-1-ol |
| SMILES | CC(C)(C)CC1=C[C@H]2CCC[C@H]2[C@@H]1C1(O)C=CCCC1 |
| InChI | InChI=1S/C19H30O/c1-18(2,3)13-15-12-14-8-7-9-16(14)17(15)19(20)10-5-4-6-11-19/h5,10,12,14,16-17,20H,4,6-9,11,13H2,1-3H3/t14-,16-,17-,19?/m1/s1 |
| InChIKey | RQWGEODAPUAPEM-BSPZJRRFSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|