C25H16F6N2S2 — CID 101411537
2-(8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-pyridin-2-yl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl)pyridine (PubChem CID 101411537) has the molecular formula C25H16F6N2S2 and a molecular weight of 522.54 g/mol. Its IUPAC name is 2-(8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-pyridin-2-yl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl)pyridine.
| Compound Name | 2-(8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-pyridin-2-yl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl)pyridine |
|---|---|
| PubChem CID | 101411537 |
| Molecular Formula | C25H16F6N2S2 |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 2-(8,8,9,9,10,10-hexafluoro-1,2-dimethyl-14-pyridin-2-yl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl)pyridine |
| SMILES | CC12SC(c3ccccn3)=CC1=C1C(=C3C=C(c4ccccn4)SC32C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C25H16F6N2S2/c1-21-13(11-17(34-21)15-7-3-5-9-32-15)19-20(24(28,29)25(30,31)23(19,26)27)14-12-18(35-22(14,21)2)16-8-4-6-10-33-16/h3-12H,1-2H3 |
| InChIKey | AHGXOPVHZDZTJK-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|