C21H38O3Si — CID 101411598
ethyl (1R,2R,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-3,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 101411598) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is ethyl (1R,2R,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-3,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1R,2R,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-3,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 101411598 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | ethyl (1R,2R,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1,2-dimethyl-3,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)[C@H](C)CC(O[Si](C)(C)C(C)(C)C)=C2CCCC[C@H]21 |
| InChI | InChI=1S/C21H38O3Si/c1-9-23-19(22)21(6)15(2)14-18(16-12-10-11-13-17(16)21)24-25(7,8)20(3,4)5/h15,17H,9-14H2,1-8H3/t15-,17-,21-/m1/s1 |
| InChIKey | ROCLFTMLYISUQN-QLVMHMETSA-N |
| XLogP | 6.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|