C40H34O7P2 — CID 101411801
dimethyl (6R,7R)-4,9-bis(diphenylphosphoryl)-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-6,7-dicarboxylate (PubChem CID 101411801) has the molecular formula C40H34O7P2 and a molecular weight of 688.65 g/mol. Its IUPAC name is dimethyl (6R,7R)-4,9-bis(diphenylphosphoryl)-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-6,7-dicarboxylate.
| Compound Name | dimethyl (6R,7R)-4,9-bis(diphenylphosphoryl)-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-6,7-dicarboxylate |
|---|---|
| PubChem CID | 101411801 |
| Molecular Formula | C40H34O7P2 |
| Molecular Weight | 688.65 g/mol |
| Exact Mass | 688.18 |
| IUPAC Name | dimethyl (6R,7R)-4,9-bis(diphenylphosphoryl)-5,6,7,8-tetrahydrobenzo[f][1]benzofuran-6,7-dicarboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c(c(P(=O)(c3ccccc3)c3ccccc3)c3occc3c2P(=O)(c2ccccc2)c2ccccc2)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C40H34O7P2/c1-45-39(41)34-25-32-33(26-35(34)40(42)46-2)38(49(44,29-19-11-5-12-20-29)30-21-13-6-14-22-30)36-31(23-24-47-36)37(32)48(43,27-15-7-3-8-16-27)28-17-9-4-10-18-28/h3-24,34-35H,25-26H2,1-2H3/t34-,35-/m1/s1 |
| InChIKey | RBTSUPRNKKICKN-VSJLXWSYSA-N |
| XLogP | 5.39 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|