C24H50O2Si2 — CID 101411883
tert-butyl-[(3-butyl-2,2-ditert-butyl-5-propyl-5H-oxasilol-4-yl)oxy]-dimethylsilane (PubChem CID 101411883) has the molecular formula C24H50O2Si2 and a molecular weight of 426.83 g/mol. Its IUPAC name is tert-butyl-[(3-butyl-2,2-ditert-butyl-5-propyl-5H-oxasilol-4-yl)oxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3-butyl-2,2-ditert-butyl-5-propyl-5H-oxasilol-4-yl)oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101411883 |
| Molecular Formula | C24H50O2Si2 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | tert-butyl-[(3-butyl-2,2-ditert-butyl-5-propyl-5H-oxasilol-4-yl)oxy]-dimethylsilane |
| SMILES | CCCCC1=C(O[Si](C)(C)C(C)(C)C)C(CCC)O[Si]1(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H50O2Si2/c1-14-16-18-20-21(26-27(12,13)22(3,4)5)19(17-15-2)25-28(20,23(6,7)8)24(9,10)11/h19H,14-18H2,1-13H3 |
| InChIKey | QIBYEGUPPYKILF-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|