C42H36B3N3O3 — CID 101411938
(4R,5S,9R,10S,14R,15S)-4,5,9,10,14,15-hexakis-phenyl-3,8,13-trioxa-1,6,11-triaza-2,7,12-triboratetracyclo[10.3.0.02,6.07,11]pentadecane (PubChem CID 101411938) has the molecular formula C42H36B3N3O3 and a molecular weight of 663.20 g/mol. Its IUPAC name is (4R,5S,9R,10S,14R,15S)-4,5,9,10,14,15-hexakis-phenyl-3,8,13-trioxa-1,6,11-triaza-2,7,12-triboratetracyclo[10.3.0.02,6.07,11]pentadecane.
| Compound Name | (4R,5S,9R,10S,14R,15S)-4,5,9,10,14,15-hexakis-phenyl-3,8,13-trioxa-1,6,11-triaza-2,7,12-triboratetracyclo[10.3.0.02,6.07,11]pentadecane |
|---|---|
| PubChem CID | 101411938 |
| Molecular Formula | C42H36B3N3O3 |
| Molecular Weight | 663.20 g/mol |
| Exact Mass | 663.30 |
| IUPAC Name | (4R,5S,9R,10S,14R,15S)-4,5,9,10,14,15-hexakis-phenyl-3,8,13-trioxa-1,6,11-triaza-2,7,12-triboratetracyclo[10.3.0.02,6.07,11]pentadecane |
| SMILES | c1ccc([C@H]2OB3N(B4O[C@H](c5ccccc5)[C@H](c5ccccc5)N4B4O[C@H](c5ccccc5)[C@H](c5ccccc5)N34)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C42H36B3N3O3/c1-7-19-31(20-8-1)37-40(34-25-13-4-14-26-34)49-43-46(37)44-48(38(32-21-9-2-10-22-32)41(50-44)35-27-15-5-16-28-35)45-47(43)39(33-23-11-3-12-24-33)42(51-45)36-29-17-6-18-30-36/h1-30,37-42H/t37-,38-,39-,40+,41+,42+/m0/s1 |
| InChIKey | TZMSYKBDQJIIDG-CRJHUGKGSA-N |
| XLogP | 8.40 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.20 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|