C17H30B2O4 — CID 101412131
2-[(2R)-2-ethenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 101412131) has the molecular formula C17H30B2O4 and a molecular weight of 320.05 g/mol. Its IUPAC name is 2-[(2R)-2-ethenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2R)-2-ethenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101412131 |
| Molecular Formula | C17H30B2O4 |
| Molecular Weight | 320.05 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 2-[(2R)-2-ethenyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C[C@@H]1CC1(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H30B2O4/c1-10-12-11-17(12,18-20-13(2,3)14(4,5)21-18)19-22-15(6,7)16(8,9)23-19/h10,12H,1,11H2,2-9H3/t12-/m1/s1 |
| InChIKey | FSBCCPCOVRFYOS-GFCCVEGCSA-N |
| XLogP | 3.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.05 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|