About (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol
(E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol (PubChem CID 101412556) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol.
Molecular Properties
| Compound Name | (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol |
| PubChem CID | 101412556 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol |
| SMILES | C=C(CO)C(O)CC/C(C)=C/CO |
| InChI | InChI=1S/C10H18O3/c1-8(5-6-11)3-4-10(13)9(2)7-12/h5,10-13H,2-4,6-7H2,1H3/b8-5+ |
| InChIKey | KSMRZTSAPKWVGY-VMPITWQZSA-N |
| XLogP | 0.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol?
The IUPAC name of (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol (CID 101412556) is (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol.
What is the SMILES notation for (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol?
The canonical SMILES for (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol is C=C(CO)C(O)CC/C(C)=C/CO.
What is the InChIKey of (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol?
The InChIKey is KSMRZTSAPKWVGY-VMPITWQZSA-N. The full InChI is InChI=1S/C10H18O3/c1-8(5-6-11)3-4-10(13)9(2)7-12/h5,10-13H,2-4,6-7H2,1H3/b8-5+.
What are the key properties of (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol?
(E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol has a molecular weight of 186.25 g/mol, XLogP of 0.61, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-methyl-2-methylideneoct-6-ene-1,3,8-triol is sourced from PubChem (CID 101412556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).