C16H20Si — CID 101413061
trimethyl-[2-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)ethynyl]silane (PubChem CID 101413061) has the molecular formula C16H20Si and a molecular weight of 240.42 g/mol. Its IUPAC name is trimethyl-[2-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)ethynyl]silane.
| Compound Name | trimethyl-[2-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)ethynyl]silane |
|---|---|
| PubChem CID | 101413061 |
| Molecular Formula | C16H20Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | trimethyl-[2-(9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)ethynyl]silane |
| SMILES | C[Si](C)(C)C#CC1CC2CC1c1ccccc12 |
| InChI | InChI=1S/C16H20Si/c1-17(2,3)9-8-12-10-13-11-16(12)15-7-5-4-6-14(13)15/h4-7,12-13,16H,10-11H2,1-3H3 |
| InChIKey | DZHBBXUNVYBJOE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|