C21H22Cl2N2O — CID 101413196
3'-(3,5-dichloro-2,4,6-trimethylphenyl)-2-methylspiro[1,3-dihydroisoquinoline-4,5'-4H-1,2-oxazole] (PubChem CID 101413196) has the molecular formula C21H22Cl2N2O and a molecular weight of 389.33 g/mol. Its IUPAC name is 3'-(3,5-dichloro-2,4,6-trimethylphenyl)-2-methylspiro[1,3-dihydroisoquinoline-4,5'-4H-1,2-oxazole].
| Compound Name | 3'-(3,5-dichloro-2,4,6-trimethylphenyl)-2-methylspiro[1,3-dihydroisoquinoline-4,5'-4H-1,2-oxazole] |
|---|---|
| PubChem CID | 101413196 |
| Molecular Formula | C21H22Cl2N2O |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3'-(3,5-dichloro-2,4,6-trimethylphenyl)-2-methylspiro[1,3-dihydroisoquinoline-4,5'-4H-1,2-oxazole] |
| SMILES | Cc1c(Cl)c(C)c(C2=NOC3(C2)CN(C)Cc2ccccc23)c(C)c1Cl |
| InChI | InChI=1S/C21H22Cl2N2O/c1-12-18(13(2)20(23)14(3)19(12)22)17-9-21(26-24-17)11-25(4)10-15-7-5-6-8-16(15)21/h5-8H,9-11H2,1-4H3 |
| InChIKey | MGNDWFLFWCGMBP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |