C12H21NO2 — CID 101413258
(3aR,6aR)-3-hexyl-2-oxido-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-2-ium (PubChem CID 101413258) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (3aR,6aR)-3-hexyl-2-oxido-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-2-ium.
| Compound Name | (3aR,6aR)-3-hexyl-2-oxido-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-2-ium |
|---|---|
| PubChem CID | 101413258 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (3aR,6aR)-3-hexyl-2-oxido-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-2-ium |
| SMILES | CCCCCCC1=[N+]([O-])O[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C12H21NO2/c1-2-3-4-5-8-11-10-7-6-9-12(10)15-13(11)14/h10,12H,2-9H2,1H3/t10-,12-/m1/s1 |
| InChIKey | VMTJFCKOLCEXLZ-ZYHUDNBSSA-N |
| XLogP | 3.02 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|