About propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate
propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate (PubChem CID 101413403) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate |
| PubChem CID | 101413403 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate |
| SMILES | CC(C)OC(=O)[C@@]1(C)CCC=[N+]1[O-] |
| InChI | InChI=1S/C9H15NO3/c1-7(2)13-8(11)9(3)5-4-6-10(9)12/h6-7H,4-5H2,1-3H3/t9-/m1/s1 |
| InChIKey | VIEBDRZQIUAMRF-SECBINFHSA-N |
| XLogP | 1.07 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
The IUPAC name of propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate (CID 101413403) is propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate.
What is the SMILES notation for propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
The canonical SMILES for propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate is CC(C)OC(=O)[C@@]1(C)CCC=[N+]1[O-].
What is the InChIKey of propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
The InChIKey is VIEBDRZQIUAMRF-SECBINFHSA-N. The full InChI is InChI=1S/C9H15NO3/c1-7(2)13-8(11)9(3)5-4-6-10(9)12/h6-7H,4-5H2,1-3H3/t9-/m1/s1.
What are the key properties of propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate?
propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate has a molecular weight of 185.22 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2R)-2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate is sourced from PubChem (CID 101413403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).