C11H16O2 — CID 101413436
(2aS,5aS,9aR)-3,4,5,5a,6,7,8,9-octahydro-2aH-naphtho[8a,1-b]oxet-2-one (PubChem CID 101413436) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (2aS,5aS,9aR)-3,4,5,5a,6,7,8,9-octahydro-2aH-naphtho[8a,1-b]oxet-2-one.
| Compound Name | (2aS,5aS,9aR)-3,4,5,5a,6,7,8,9-octahydro-2aH-naphtho[8a,1-b]oxet-2-one |
|---|---|
| PubChem CID | 101413436 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2aS,5aS,9aR)-3,4,5,5a,6,7,8,9-octahydro-2aH-naphtho[8a,1-b]oxet-2-one |
| SMILES | O=C1O[C@]23CCCC[C@H]2CCC[C@H]13 |
| InChI | InChI=1S/C11H16O2/c12-10-9-6-3-5-8-4-1-2-7-11(8,9)13-10/h8-9H,1-7H2/t8-,9+,11+/m0/s1 |
| InChIKey | VLNAGUYZUNOQDZ-IQJOONFLSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|