C16H26O2Si — CID 101413550
(1S,2R,4E,5S,6S)-6,8-dimethyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol (PubChem CID 101413550) has the molecular formula C16H26O2Si and a molecular weight of 278.47 g/mol. Its IUPAC name is (1S,2R,4E,5S,6S)-6,8-dimethyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol.
| Compound Name | (1S,2R,4E,5S,6S)-6,8-dimethyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol |
|---|---|
| PubChem CID | 101413550 |
| Molecular Formula | C16H26O2Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (1S,2R,4E,5S,6S)-6,8-dimethyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol |
| SMILES | CC1=C[C@@]23CO[C@@](C)(C1)[C@@H]2/C(=C/[Si](C)(C)C)C[C@H]3O |
| InChI | InChI=1S/C16H26O2Si/c1-11-7-15(2)14-12(9-19(3,4)5)6-13(17)16(14,8-11)10-18-15/h8-9,13-14,17H,6-7,10H2,1-5H3/b12-9+/t13-,14+,15+,16+/m1/s1 |
| InChIKey | KVMFRYKWSHRBJI-KJHILAFTSA-N |
| XLogP | 3.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|