C16H26O3Si — CID 101413555
(1S,2R,4E,5S,6S)-6-methoxy-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol (PubChem CID 101413555) has the molecular formula C16H26O3Si and a molecular weight of 294.47 g/mol. Its IUPAC name is (1S,2R,4E,5S,6S)-6-methoxy-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol.
| Compound Name | (1S,2R,4E,5S,6S)-6-methoxy-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol |
|---|---|
| PubChem CID | 101413555 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (1S,2R,4E,5S,6S)-6-methoxy-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol |
| SMILES | CO[C@@]12CC(C)=C[C@]3(CO1)[C@H](O)C/C(=C\[Si](C)(C)C)[C@@H]23 |
| InChI | InChI=1S/C16H26O3Si/c1-11-7-15-10-19-16(8-11,18-2)14(15)12(6-13(15)17)9-20(3,4)5/h7,9,13-14,17H,6,8,10H2,1-5H3/b12-9+/t13-,14-,15+,16+/m1/s1 |
| InChIKey | HZCZOPZWQWPAPC-OSUIPTSTSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|