About (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one
(10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one (PubChem CID 101414103) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one.
Molecular Properties
| Compound Name | (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one |
| PubChem CID | 101414103 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one |
| SMILES | O=C1C=C[C@@H](O)CC2(C1)OCCO2 |
| InChI | InChI=1S/C9H12O4/c10-7-1-2-8(11)6-9(5-7)12-3-4-13-9/h1-2,7,10H,3-6H2/t7-/m1/s1 |
| InChIKey | ZOVHVODCZRXFMM-SSDOTTSWSA-N |
| XLogP | 0.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one?
The IUPAC name of (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one (CID 101414103) is (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one.
What is the SMILES notation for (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one?
The canonical SMILES for (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one is O=C1C=C[C@@H](O)CC2(C1)OCCO2.
What is the InChIKey of (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one?
The InChIKey is ZOVHVODCZRXFMM-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H12O4/c10-7-1-2-8(11)6-9(5-7)12-3-4-13-9/h1-2,7,10H,3-6H2/t7-/m1/s1.
What are the key properties of (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one?
(10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one has a molecular weight of 184.19 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (10S)-10-hydroxy-1,4-dioxaspiro[4.6]undec-8-en-7-one is sourced from PubChem (CID 101414103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).