C20H18O — CID 101414130
2-methyl-5,5-bis(4-methylphenyl)penta-2,3,4-trienal (PubChem CID 101414130) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-methyl-5,5-bis(4-methylphenyl)penta-2,3,4-trienal.
| Compound Name | 2-methyl-5,5-bis(4-methylphenyl)penta-2,3,4-trienal |
|---|---|
| PubChem CID | 101414130 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-methyl-5,5-bis(4-methylphenyl)penta-2,3,4-trienal |
| SMILES | CC(=C=C=C(c1ccc(C)cc1)c1ccc(C)cc1)C=O |
| InChI | InChI=1S/C20H18O/c1-15-4-9-18(10-5-15)20(13-8-17(3)14-21)19-11-6-16(2)7-12-19/h4-7,9-12,14H,1-3H3 |
| InChIKey | IHQPVKKUJGBQGE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|