C29H29F12NOSi — CID 101414384
[bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-1-[(1E,3E)-penta-1,3-dienyl]pyrrolidin-2-yl]methoxy]-trimethylsilane (PubChem CID 101414384) has the molecular formula C29H29F12NOSi and a molecular weight of 663.62 g/mol. Its IUPAC name is [bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-1-[(1E,3E)-penta-1,3-dienyl]pyrrolidin-2-yl]methoxy]-trimethylsilane.
| Compound Name | [bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-1-[(1E,3E)-penta-1,3-dienyl]pyrrolidin-2-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 101414384 |
| Molecular Formula | C29H29F12NOSi |
| Molecular Weight | 663.62 g/mol |
| Exact Mass | 663.18 |
| IUPAC Name | [bis[3,5-bis(trifluoromethyl)phenyl]-[(2S)-1-[(1E,3E)-penta-1,3-dienyl]pyrrolidin-2-yl]methoxy]-trimethylsilane |
| SMILES | C/C=C/C=C/N1CCC[C@H]1C(O[Si](C)(C)C)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H29F12NOSi/c1-5-6-7-10-42-11-8-9-24(42)25(43-44(2,3)4,18-12-20(26(30,31)32)16-21(13-18)27(33,34)35)19-14-22(28(36,37)38)17-23(15-19)29(39,40)41/h5-7,10,12-17,24H,8-9,11H2,1-4H3/b6-5+,10-7+/t24-/m0/s1 |
| InChIKey | OTLGYHTUIHLQTF-CRVJJOQTSA-N |
| XLogP | 10.41 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.62 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|