About trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane
trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane (PubChem CID 101414432) has the molecular formula C11H18Si
and a molecular weight of 178.35 g/mol. Its IUPAC name is trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane.
Molecular Properties
| Compound Name | trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane |
| PubChem CID | 101414432 |
| Molecular Formula | C11H18Si |
| Molecular Weight | 178.35 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane |
| SMILES | C=C/C=C/CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C11H18Si/c1-5-6-7-8-9-10-11-12(2,3)4/h5-7H,1,8-9H2,2-4H3/b7-6+ |
| InChIKey | IZWXXXFBRUTVQO-VOTSOKGWSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane?
The IUPAC name of trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane (CID 101414432) is trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane.
What is the SMILES notation for trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane?
The canonical SMILES for trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane is C=C/C=C/CCC#C[Si](C)(C)C.
What is the InChIKey of trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane?
The InChIKey is IZWXXXFBRUTVQO-VOTSOKGWSA-N. The full InChI is InChI=1S/C11H18Si/c1-5-6-7-8-9-10-11-12(2,3)4/h5-7H,1,8-9H2,2-4H3/b7-6+.
What are the key properties of trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane?
trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane has a molecular weight of 178.35 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(5E)-octa-5,7-dien-1-ynyl]silane is sourced from PubChem (CID 101414432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).