C30H34N6O — CID 10141451
N-cyclopentyl-3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(3-prop-2-enoxyphenyl)imidazo[1,2-a]pyridin-8-amine (PubChem CID 10141451) has the molecular formula C30H34N6O and a molecular weight of 494.64 g/mol. Its IUPAC name is N-cyclopentyl-3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(3-prop-2-enoxyphenyl)imidazo[1,2-a]pyridin-8-amine.
| Compound Name | N-cyclopentyl-3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(3-prop-2-enoxyphenyl)imidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 10141451 |
| Molecular Formula | C30H34N6O |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | N-cyclopentyl-3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(3-prop-2-enoxyphenyl)imidazo[1,2-a]pyridin-8-amine |
| SMILES | C=CCOc1cccc(-c2nc3c(NC4CCCC4)cccn3c2-c2ccnc(NC3CCCC3)n2)c1 |
| InChI | InChI=1S/C30H34N6O/c1-2-19-37-24-14-7-9-21(20-24)27-28(25-16-17-31-30(34-25)33-23-12-5-6-13-23)36-18-8-15-26(29(36)35-27)32-22-10-3-4-11-22/h2,7-9,14-18,20,22-23,32H,1,3-6,10-13,19H2,(H,31,33,34) |
| InChIKey | QLKWIAJMBCQYCG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|