C23H24F3NO3 — CID 101414614
[(3S,4R)-1-benzyl-4-ethenylpyrrolidin-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 101414614) has the molecular formula C23H24F3NO3 and a molecular weight of 419.44 g/mol. Its IUPAC name is [(3S,4R)-1-benzyl-4-ethenylpyrrolidin-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(3S,4R)-1-benzyl-4-ethenylpyrrolidin-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 101414614 |
| Molecular Formula | C23H24F3NO3 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [(3S,4R)-1-benzyl-4-ethenylpyrrolidin-3-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C[C@@H]1CN(Cc2ccccc2)C[C@H]1OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C23H24F3NO3/c1-3-18-15-27(14-17-10-6-4-7-11-17)16-20(18)30-21(28)22(29-2,23(24,25)26)19-12-8-5-9-13-19/h3-13,18,20H,1,14-16H2,2H3/t18-,20-,22-/m1/s1 |
| InChIKey | CJGPUIBMJBCWHZ-SYYKKAFVSA-N |
| XLogP | 4.32 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|